C12H19N3O3S — CID 12766140
ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetate (PubChem CID 12766140) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetate.
| Compound Name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetate |
|---|---|
| PubChem CID | 12766140 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-pentoxyiminoacetate |
| SMILES | CCCCCO/N=C(\C(=O)OCC)c1csc(N)n1 |
| InChI | InChI=1S/C12H19N3O3S/c1-3-5-6-7-18-15-10(11(16)17-4-2)9-8-19-12(13)14-9/h8H,3-7H2,1-2H3,(H2,13,14)/b15-10- |
| InChIKey | WEDOYODBYFGEFJ-GDNBJRDFSA-N |
| XLogP | 2.20 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|