C10H14N4O4S — CID 173401753
ethyl 2-[(Z)-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxypropanoate (PubChem CID 173401753) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is ethyl 2-[(Z)-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxypropanoate.
| Compound Name | ethyl 2-[(Z)-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 173401753 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | ethyl 2-[(Z)-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxypropanoate |
| SMILES | CCOC(=O)C(C)O/N=C(\C(N)=O)c1csc(N)n1 |
| InChI | InChI=1S/C10H14N4O4S/c1-3-17-9(16)5(2)18-14-7(8(11)15)6-4-19-10(12)13-6/h4-5H,3H2,1-2H3,(H2,11,15)(H2,12,13)/b14-7- |
| InChIKey | INVJQNMYNIORIZ-AUWJEWJLSA-N |
| XLogP | -0.12 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|