C7H10N2O2S — CID 58670395
propyl 2-amino-1,3-thiazole-4-carboxylate (PubChem CID 58670395) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is propyl 2-amino-1,3-thiazole-4-carboxylate.
| Compound Name | propyl 2-amino-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 58670395 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | propyl 2-amino-1,3-thiazole-4-carboxylate |
| SMILES | CCCOC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-3-11-6(10)5-4-12-7(8)9-5/h4H,2-3H2,1H3,(H2,8,9) |
| InChIKey | NBMVHMYIMJDFEE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |