C12H12N2O3S — CID 175547229
(3-methoxyphenyl)methyl 2-amino-1,3-thiazole-4-carboxylate (PubChem CID 175547229) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-amino-1,3-thiazole-4-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 2-amino-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 175547229 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-amino-1,3-thiazole-4-carboxylate |
| SMILES | COc1cccc(COC(=O)c2csc(N)n2)c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-16-9-4-2-3-8(5-9)6-17-11(15)10-7-18-12(13)14-10/h2-5,7H,6H2,1H3,(H2,13,14) |
| InChIKey | HJYUPWIQDSHSDD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |