C14H25N3OS — CID 62788074
2-amino-N,N-dipentyl-1,3-thiazole-4-carboxamide (PubChem CID 62788074) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-amino-N,N-dipentyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N,N-dipentyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62788074 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-amino-N,N-dipentyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1csc(N)n1 |
| InChI | InChI=1S/C14H25N3OS/c1-3-5-7-9-17(10-8-6-4-2)13(18)12-11-19-14(15)16-12/h11H,3-10H2,1-2H3,(H2,15,16) |
| InChIKey | ZKLXDZHWFGKQDE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|