C11H20N4OS — CID 55116109
2-amino-N-[3-(diethylamino)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 55116109) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-amino-N-[3-(diethylamino)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-[3-(diethylamino)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55116109 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-amino-N-[3-(diethylamino)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C11H20N4OS/c1-3-15(4-2)7-5-6-13-10(16)9-8-17-11(12)14-9/h8H,3-7H2,1-2H3,(H2,12,14)(H,13,16) |
| InChIKey | MYXSPDWDBXMMAE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|