C11H19N5O2S — CID 40690239
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-(diethylamino)ethyl]-2-hydroxyiminoacetamide (PubChem CID 40690239) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-(diethylamino)ethyl]-2-hydroxyiminoacetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-(diethylamino)ethyl]-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 40690239 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[2-(diethylamino)ethyl]-2-hydroxyiminoacetamide |
| SMILES | CCN(CC)CCNC(=O)/C(=N\O)c1csc(N)n1 |
| InChI | InChI=1S/C11H19N5O2S/c1-3-16(4-2)6-5-13-10(17)9(15-18)8-7-19-11(12)14-8/h7,18H,3-6H2,1-2H3,(H2,12,14)(H,13,17)/b15-9- |
| InChIKey | JZWMJCNWXVSXSQ-DHDCSXOGSA-N |
| XLogP | 0.36 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|