C10H14N4O3S — CID 71965749
2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 71965749) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 71965749 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyimino-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Nc1nc(C(=NO)C(=O)NCC2CCCO2)cs1 |
| InChI | InChI=1S/C10H14N4O3S/c11-10-13-7(5-18-10)8(14-16)9(15)12-4-6-2-1-3-17-6/h5-6,16H,1-4H2,(H2,11,13)(H,12,15) |
| InChIKey | XUSQFZAXCUNUGJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|