C15H17N3O3S2 — CID 99801698
N'-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 99801698) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N'-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 99801698 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N'-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C(=O)NC[C@@H]3CCCO3)n2)s1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-9-4-5-12(23-9)11-8-22-15(17-11)18-14(20)13(19)16-7-10-3-2-6-21-10/h4-5,8,10H,2-3,6-7H2,1H3,(H,16,19)(H,17,18,20)/t10-/m0/s1 |
| InChIKey | YRMQUUSFFHSQJF-JTQLQIEISA-N |
| XLogP | 2.41 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|