C9H13N3O2S — CID 82171903
2-amino-N-(oxolan-2-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 82171903) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-amino-N-(oxolan-2-ylmethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(oxolan-2-ylmethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 82171903 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-amino-N-(oxolan-2-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ncc(C(=O)NCC2CCCO2)s1 |
| InChI | InChI=1S/C9H13N3O2S/c10-9-12-5-7(15-9)8(13)11-4-6-2-1-3-14-6/h5-6H,1-4H2,(H2,10,12)(H,11,13) |
| InChIKey | WDIJKWVWXCSRAP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |