C10H11Br2NO2S — CID 25402358
4,5-dibromo-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 25402358) has the molecular formula C10H11Br2NO2S and a molecular weight of 369.08 g/mol. Its IUPAC name is 4,5-dibromo-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25402358 |
| Molecular Formula | C10H11Br2NO2S |
| Molecular Weight | 369.08 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | 4,5-dibromo-N-[[(2S)-oxolan-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H11Br2NO2S/c11-7-4-8(16-9(7)12)10(14)13-5-6-2-1-3-15-6/h4,6H,1-3,5H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | DSUIACUGYRAPGO-LURJTMIESA-N |
| XLogP | 3.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |