C15H21NO2 — CID 95970650
2,4,5-trimethyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 95970650) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2,4,5-trimethyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95970650 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2,4,5-trimethyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NC[C@H]2CCCO2)cc1C |
| InChI | InChI=1S/C15H21NO2/c1-10-7-12(3)14(8-11(10)2)15(17)16-9-13-5-4-6-18-13/h7-8,13H,4-6,9H2,1-3H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | ZOBMRESSYIYDGK-CYBMUJFWSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |