C12H14BF3NO2- — CID 99738286
trifluoro-[4-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]boranuide (PubChem CID 99738286) has the molecular formula C12H14BF3NO2- and a molecular weight of 272.05 g/mol. Its IUPAC name is trifluoro-[4-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]boranuide.
| Compound Name | trifluoro-[4-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]boranuide |
|---|---|
| PubChem CID | 99738286 |
| Molecular Formula | C12H14BF3NO2- |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | trifluoro-[4-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]boranuide |
| SMILES | O=C(NC[C@H]1CCCO1)c1ccc([B-](F)(F)F)cc1 |
| InChI | InChI=1S/C12H14BF3NO2/c14-13(15,16)10-5-3-9(4-6-10)12(18)17-8-11-2-1-7-19-11/h3-6,11H,1-2,7-8H2,(H,17,18)/q-1/t11-/m1/s1 |
| InChIKey | BMPRYXAJXNLVKX-LLVKDONJSA-N |
| XLogP | 1.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|