C14H19NO3 — CID 2850672
4-ethoxy-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 2850672) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-ethoxy-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-ethoxy-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2850672 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-ethoxy-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-2-17-12-7-5-11(6-8-12)14(16)15-10-13-4-3-9-18-13/h5-8,13H,2-4,9-10H2,1H3,(H,15,16) |
| InChIKey | BRXPDXWJJZEAOH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |