C23H28N4O5 — CID 55527840
4-ethoxy-N-[2-oxo-2-[4-(oxolan-2-ylmethylcarbamoylamino)anilino]ethyl]benzamide (PubChem CID 55527840) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-ethoxy-N-[2-oxo-2-[4-(oxolan-2-ylmethylcarbamoylamino)anilino]ethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-oxo-2-[4-(oxolan-2-ylmethylcarbamoylamino)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 55527840 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-ethoxy-N-[2-oxo-2-[4-(oxolan-2-ylmethylcarbamoylamino)anilino]ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2ccc(NC(=O)NCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O5/c1-2-31-19-11-5-16(6-12-19)22(29)24-15-21(28)26-17-7-9-18(10-8-17)27-23(30)25-14-20-4-3-13-32-20/h5-12,20H,2-4,13-15H2,1H3,(H,24,29)(H,26,28)(H2,25,27,30) |
| InChIKey | XDHBICFWXOKNCY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |