C25H31N3O5 — CID 55527756
4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-4-(4-propoxyphenyl)butanamide (PubChem CID 55527756) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-4-(4-propoxyphenyl)butanamide.
| Compound Name | 4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-4-(4-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 55527756 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-4-(4-propoxyphenyl)butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)Nc2ccc(NC(=O)NCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-2-15-32-21-11-5-18(6-12-21)23(29)13-14-24(30)27-19-7-9-20(10-8-19)28-25(31)26-17-22-4-3-16-33-22/h5-12,22H,2-4,13-17H2,1H3,(H,27,30)(H2,26,28,31) |
| InChIKey | REDODOVGMGYWOK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |