C20H29N3O3 — CID 54816576
4-[[2-(cyclohexylamino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54816576) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[[2-(cyclohexylamino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[2-(cyclohexylamino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54816576 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-[[2-(cyclohexylamino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CNC1CCCCC1)Nc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H29N3O3/c24-19(14-21-16-5-2-1-3-6-16)23-17-10-8-15(9-11-17)20(25)22-13-18-7-4-12-26-18/h8-11,16,18,21H,1-7,12-14H2,(H,22,25)(H,23,24) |
| InChIKey | PCMMRWSBNOODJB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |