C23H29N3O3 — CID 54811884
N-(oxolan-2-ylmethyl)-4-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide (PubChem CID 54811884) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54811884 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide |
| SMILES | Cc1cc(C)c(NCC(=O)Nc2ccc(C(=O)NCC3CCCO3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H29N3O3/c1-15-11-16(2)22(17(3)12-15)24-14-21(27)26-19-8-6-18(7-9-19)23(28)25-13-20-5-4-10-29-20/h6-9,11-12,20,24H,4-5,10,13-14H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | OIWDLEDYYVIARC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |