C22H27N3O3 — CID 54818429
4-[[2-(2,6-dimethylanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54818429) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[[2-(2,6-dimethylanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[2-(2,6-dimethylanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54818429 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[[2-(2,6-dimethylanilino)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1cccc(C)c1NCC(=O)Nc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-15-5-3-6-16(2)21(15)23-14-20(26)25-18-10-8-17(9-11-18)22(27)24-13-19-7-4-12-28-19/h3,5-6,8-11,19,23H,4,7,12-14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | WSIGDCVYOYPGJX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |