C28H31N3O5 — CID 54836568
N-(oxolan-2-ylmethyl)-4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide (PubChem CID 54836568) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54836568 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(C(=O)NCC2CCCO2)cc1)Nc1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O5/c32-27(20-29-22-10-8-21(9-11-22)28(33)30-19-26-7-4-16-34-26)31-23-12-14-25(15-13-23)36-18-17-35-24-5-2-1-3-6-24/h1-3,5-6,8-15,26,29H,4,7,16-20H2,(H,30,33)(H,31,32) |
| InChIKey | HVUZQEGPRCSZOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|