C25H31N3O5 — CID 54829444
4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54829444) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54829444 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CNc1ccccc1OCC1CCCO1)Nc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H31N3O5/c29-24(16-26-22-7-1-2-8-23(22)33-17-21-6-4-14-32-21)28-19-11-9-18(10-12-19)25(30)27-15-20-5-3-13-31-20/h1-2,7-12,20-21,26H,3-6,13-17H2,(H,27,30)(H,28,29) |
| InChIKey | GBDRHAWNZDNZOQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |