C26H33N3O4 — CID 54829639
N-cyclohexyl-4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzamide (PubChem CID 54829639) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54829639 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-cyclohexyl-4-[[2-[2-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzamide |
| SMILES | O=C(CNc1ccccc1OCC1CCCO1)Nc1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H33N3O4/c30-25(17-27-23-10-4-5-11-24(23)33-18-22-9-6-16-32-22)28-21-14-12-19(13-15-21)26(31)29-20-7-2-1-3-8-20/h4-5,10-15,20,22,27H,1-3,6-9,16-18H2,(H,28,30)(H,29,31) |
| InChIKey | NIFJXKVZLKDWHY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |