C23H29N3O2 — CID 54816101
N-cyclohexyl-4-[[2-(2,3-dimethylanilino)acetyl]amino]benzamide (PubChem CID 54816101) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-(2,3-dimethylanilino)acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-4-[[2-(2,3-dimethylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54816101 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-cyclohexyl-4-[[2-(2,3-dimethylanilino)acetyl]amino]benzamide |
| SMILES | Cc1cccc(NCC(=O)Nc2ccc(C(=O)NC3CCCCC3)cc2)c1C |
| InChI | InChI=1S/C23H29N3O2/c1-16-7-6-10-21(17(16)2)24-15-22(27)25-20-13-11-18(12-14-20)23(28)26-19-8-4-3-5-9-19/h6-7,10-14,19,24H,3-5,8-9,15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | PGXZORWMOINIJI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |