C26H34N4O3 — CID 54843789
N-cyclohexyl-4-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54843789) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-cyclohexyl-4-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54843789 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-cyclohexyl-4-[[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNc2ccc(C(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O3/c1-3-30(4-2)26(33)20-12-16-23(17-13-20)28-24(31)18-27-21-14-10-19(11-15-21)25(32)29-22-8-6-5-7-9-22/h10-17,22,27H,3-9,18H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | MJMACPFUJMKFEI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |