C25H27N3O5 — CID 54843141
N-(furan-2-ylmethyl)-4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide (PubChem CID 54843141) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54843141 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(C(=O)NCc2ccco2)cc1)Nc1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C25H27N3O5/c29-24(28-22-7-1-2-8-23(22)33-17-21-6-4-14-32-21)16-26-19-11-9-18(10-12-19)25(30)27-15-20-5-3-13-31-20/h1-3,5,7-13,21,26H,4,6,14-17H2,(H,27,30)(H,28,29) |
| InChIKey | HOQBUEYRYLFLJF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |