C26H35N3O4 — CID 54831866
4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]-N,N-dipropylbenzamide (PubChem CID 54831866) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54831866 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 4-[[2-oxo-2-[2-(oxolan-2-ylmethoxy)anilino]ethyl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NCC(=O)Nc2ccccc2OCC2CCCO2)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-3-15-29(16-4-2)26(31)20-11-13-21(14-12-20)27-18-25(30)28-23-9-5-6-10-24(23)33-19-22-8-7-17-32-22/h5-6,9-14,22,27H,3-4,7-8,15-19H2,1-2H3,(H,28,30) |
| InChIKey | XAWVGQPSXZCIIH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |