C25H33N3O4 — CID 54836756
4-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54836756) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54836756 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 4-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC(C)CCOc1cccc(NC(=O)CNc2ccc(C(=O)NCC3CCCO3)cc2)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-18(2)12-14-32-22-6-3-5-21(15-22)28-24(29)17-26-20-10-8-19(9-11-20)25(30)27-16-23-7-4-13-31-23/h3,5-6,8-11,15,18,23,26H,4,7,12-14,16-17H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | VLKBWDHZCKMTPD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |