C24H29N3O4 — CID 54836834
3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 54836834) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54836834 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | C=C(C)COc1cccc(NC(=O)CNc2cccc(C(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C24H29N3O4/c1-17(2)16-31-21-9-4-8-20(13-21)27-23(28)15-25-19-7-3-6-18(12-19)24(29)26-14-22-10-5-11-30-22/h3-4,6-9,12-13,22,25H,1,5,10-11,14-16H2,2H3,(H,26,29)(H,27,28) |
| InChIKey | JUEVZAWIYIPNEL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|