C12H16BNO4 — CID 99773201
[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]boronic acid (PubChem CID 99773201) has the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. Its IUPAC name is [4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]boronic acid.
| Compound Name | [4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 99773201 |
| Molecular Formula | C12H16BNO4 |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]boronic acid |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C12H16BNO4/c15-12(14-8-11-2-1-7-18-11)9-3-5-10(6-4-9)13(16)17/h3-6,11,16-17H,1-2,7-8H2,(H,14,15)/t11-/m0/s1 |
| InChIKey | BAQWKOHCDPHSRV-NSHDSACASA-N |
| XLogP | -0.72 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.07 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|