C21H30N2O4 — CID 3519038
2,4,6-trimethyl-1-N,3-N-bis(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 3519038) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-N,3-N-bis(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 2,4,6-trimethyl-1-N,3-N-bis(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3519038 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2,4,6-trimethyl-1-N,3-N-bis(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | Cc1cc(C)c(C(=O)NCC2CCCO2)c(C)c1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C21H30N2O4/c1-13-10-14(2)19(21(25)23-12-17-7-5-9-27-17)15(3)18(13)20(24)22-11-16-6-4-8-26-16/h10,16-17H,4-9,11-12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | AUWCTYRHLWMLHQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |