C13H17Br2NO3S — CID 78912774
4,5-dibromo-N-[3-(oxolan-2-ylmethoxy)propyl]thiophene-2-carboxamide (PubChem CID 78912774) has the molecular formula C13H17Br2NO3S and a molecular weight of 427.16 g/mol. Its IUPAC name is 4,5-dibromo-N-[3-(oxolan-2-ylmethoxy)propyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[3-(oxolan-2-ylmethoxy)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78912774 |
| Molecular Formula | C13H17Br2NO3S |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 4,5-dibromo-N-[3-(oxolan-2-ylmethoxy)propyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCOCC1CCCO1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H17Br2NO3S/c14-10-7-11(20-12(10)15)13(17)16-4-2-5-18-8-9-3-1-6-19-9/h7,9H,1-6,8H2,(H,16,17) |
| InChIKey | NZSYRAYYHMYVOJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|