C10H13BrN2O5S — CID 65374946
5-bromo-N-(oxolan-2-ylmethyl)-4-sulfamoylfuran-2-carboxamide (PubChem CID 65374946) has the molecular formula C10H13BrN2O5S and a molecular weight of 353.19 g/mol. Its IUPAC name is 5-bromo-N-(oxolan-2-ylmethyl)-4-sulfamoylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-(oxolan-2-ylmethyl)-4-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 65374946 |
| Molecular Formula | C10H13BrN2O5S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 5-bromo-N-(oxolan-2-ylmethyl)-4-sulfamoylfuran-2-carboxamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCC2CCCO2)oc1Br |
| InChI | InChI=1S/C10H13BrN2O5S/c11-9-8(19(12,15)16)4-7(18-9)10(14)13-5-6-2-1-3-17-6/h4,6H,1-3,5H2,(H,13,14)(H2,12,15,16) |
| InChIKey | VANFWKYCASGXLM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |