C7H8N4O4S — CID 172922622
2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl](15N)amino]acetic acid (PubChem CID 172922622) has the molecular formula C7H8N4O4S and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl](15N)amino]acetic acid.
| Compound Name | 2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl](15N)amino]acetic acid |
|---|---|
| PubChem CID | 172922622 |
| Molecular Formula | C7H8N4O4S |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl](15N)amino]acetic acid |
| SMILES | Nc1nc(/C(=N/O)C(=O)[15NH][13CH2][13C](=O)O)cs1 |
| InChI | InChI=1S/C7H8N4O4S/c8-7-10-3(2-16-7)5(11-15)6(14)9-1-4(12)13/h2,15H,1H2,(H2,8,10)(H,9,14)(H,12,13)/b11-5-/i1+1,4+1,9+1 |
| InChIKey | JFHNSSMBYZTXNM-FSYUXKGCSA-N |
| XLogP | -0.90 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|