C7H9N3O2S — CID 76732272
1-(2-amino-1,3-thiazol-4-yl)-1-(hydroxymethylimino)propan-2-one (PubChem CID 76732272) has the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-4-yl)-1-(hydroxymethylimino)propan-2-one.
| Compound Name | 1-(2-amino-1,3-thiazol-4-yl)-1-(hydroxymethylimino)propan-2-one |
|---|---|
| PubChem CID | 76732272 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-4-yl)-1-(hydroxymethylimino)propan-2-one |
| SMILES | CC(=O)C(=NCO)c1csc(N)n1 |
| InChI | InChI=1S/C7H9N3O2S/c1-4(12)6(9-3-11)5-2-13-7(8)10-5/h2,11H,3H2,1H3,(H2,8,10) |
| InChIKey | AFXPRMPDQIBSAA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|