C7H8N4O3S — CID 56631169
[[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate (PubChem CID 56631169) has the molecular formula C7H8N4O3S and a molecular weight of 228.23 g/mol. Its IUPAC name is [[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate.
| Compound Name | [[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 56631169 |
| Molecular Formula | C7H8N4O3S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | [[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)ON=C(C(N)=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H8N4O3S/c1-3(12)14-11-5(6(8)13)4-2-15-7(9)10-4/h2H,1H3,(H2,8,13)(H2,9,10) |
| InChIKey | WHLSCMAFVKBTHI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|