C7H8ClN3O3S — CID 173328126
[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate;hydrochloride (PubChem CID 173328126) has the molecular formula C7H8ClN3O3S and a molecular weight of 249.68 g/mol. Its IUPAC name is [(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate;hydrochloride.
| Compound Name | [(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate;hydrochloride |
|---|---|
| PubChem CID | 173328126 |
| Molecular Formula | C7H8ClN3O3S |
| Molecular Weight | 249.68 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | [(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino] acetate;hydrochloride |
| SMILES | CC(=O)O/N=C(\C=O)c1csc(N)n1.Cl |
| InChI | InChI=1S/C7H7N3O3S.ClH/c1-4(12)13-10-5(2-11)6-3-14-7(8)9-6;/h2-3H,1H3,(H2,8,9);1H/b10-5+; |
| InChIKey | BJAABLKMNQHUQJ-OAZHBLANSA-N |
| XLogP | 0.61 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.68 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|