C9H11N3O2S — CID 54409344
2-(2-amino-1,3-thiazol-4-yl)-2-but-3-enoxyiminoacetaldehyde (PubChem CID 54409344) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-but-3-enoxyiminoacetaldehyde.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-but-3-enoxyiminoacetaldehyde |
|---|---|
| PubChem CID | 54409344 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-but-3-enoxyiminoacetaldehyde |
| SMILES | C=CCCON=C(C=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H11N3O2S/c1-2-3-4-14-12-7(5-13)8-6-15-9(10)11-8/h2,5-6H,1,3-4H2,(H2,10,11) |
| InChIKey | GFRTWEXRQMXBBN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|