C13H17N3O6S — CID 173367453
[2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 173367453) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is [2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173367453 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CO/N=C(\C=O)c1csc(N)n1 |
| InChI | InChI=1S/C13H17N3O6S/c1-13(2,3)11(19)21-7-20-10(18)5-22-16-8(4-17)9-6-23-12(14)15-9/h4,6H,5,7H2,1-3H3,(H2,14,15)/b16-8+ |
| InChIKey | CXXNBBPKHZASLW-LZYBPNLTSA-N |
| XLogP | 0.73 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|