C8H9N3O4S2 — CID 175385566
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoethanethioic S-acid (PubChem CID 175385566) has the molecular formula C8H9N3O4S2 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoethanethioic S-acid.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoethanethioic S-acid |
|---|---|
| PubChem CID | 175385566 |
| Molecular Formula | C8H9N3O4S2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoethanethioic S-acid |
| SMILES | COC(=O)CO/N=C(\C(=O)S)c1csc(N)n1 |
| InChI | InChI=1S/C8H9N3O4S2/c1-14-5(12)2-15-11-6(7(13)16)4-3-17-8(9)10-4/h3H,2H2,1H3,(H2,9,10)(H,13,16)/b11-6- |
| InChIKey | CDLRQQOVWKYGBV-WDZFZDKYSA-N |
| XLogP | 0.08 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|