C10H13N3O2S2 — CID 54129320
2-(2-amino-1,3-thiazol-4-yl)-2-cyclopentyloxyiminoethanethioic S-acid (PubChem CID 54129320) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-cyclopentyloxyiminoethanethioic S-acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-cyclopentyloxyiminoethanethioic S-acid |
|---|---|
| PubChem CID | 54129320 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-cyclopentyloxyiminoethanethioic S-acid |
| SMILES | Nc1nc(C(=NOC2CCCC2)C(=O)S)cs1 |
| InChI | InChI=1S/C10H13N3O2S2/c11-10-12-7(5-17-10)8(9(14)16)13-15-6-3-1-2-4-6/h5-6H,1-4H2,(H2,11,12)(H,14,16) |
| InChIKey | NTFPPZDNKVMDLX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|