C15H23N3O3S — CID 54129549
2-(2-amino-1,3-thiazol-4-yl)-2-(4-tert-butylcyclohexyl)oxyiminoacetic acid (PubChem CID 54129549) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-(4-tert-butylcyclohexyl)oxyiminoacetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-(4-tert-butylcyclohexyl)oxyiminoacetic acid |
|---|---|
| PubChem CID | 54129549 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-(4-tert-butylcyclohexyl)oxyiminoacetic acid |
| SMILES | CC(C)(C)C1CCC(ON=C(C(=O)O)c2csc(N)n2)CC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)9-4-6-10(7-5-9)21-18-12(13(19)20)11-8-22-14(16)17-11/h8-10H,4-7H2,1-3H3,(H2,16,17)(H,19,20) |
| InChIKey | NTJNXUOXJSHKCY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|