C9H10N4O4S — CID 86742631
(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S)-2-oxopyrrolidin-3-yl]oxyiminoacetic acid (PubChem CID 86742631) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S)-2-oxopyrrolidin-3-yl]oxyiminoacetic acid.
| Compound Name | (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S)-2-oxopyrrolidin-3-yl]oxyiminoacetic acid |
|---|---|
| PubChem CID | 86742631 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-[(3S)-2-oxopyrrolidin-3-yl]oxyiminoacetic acid |
| SMILES | Nc1nc(/C(=N\O[C@H]2CCNC2=O)C(=O)O)cs1 |
| InChI | InChI=1S/C9H10N4O4S/c10-9-12-4(3-18-9)6(8(15)16)13-17-5-1-2-11-7(5)14/h3,5H,1-2H2,(H2,10,12)(H,11,14)(H,15,16)/b13-6+/t5-/m0/s1 |
| InChIKey | BRDCTHURHOTUAP-LQUGBXFWSA-N |
| XLogP | -0.58 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|