C8H9N3O3S — CID 88500468
(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetic acid (PubChem CID 88500468) has the molecular formula C8H9N3O3S and a molecular weight of 227.24 g/mol. Its IUPAC name is (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetic acid.
| Compound Name | (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetic acid |
|---|---|
| PubChem CID | 88500468 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetic acid |
| SMILES | C=CCO/N=C(/C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C8H9N3O3S/c1-2-3-14-11-6(7(12)13)5-4-15-8(9)10-5/h2,4H,1,3H2,(H2,9,10)(H,12,13)/b11-6+ |
| InChIKey | XREFUKRWVAOIOJ-IZZDOVSWSA-N |
| XLogP | 0.72 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|