C7H7N4NaO3S — CID 173396804
sodium;2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetic acid;hydride (PubChem CID 173396804) has the molecular formula C7H7N4NaO3S and a molecular weight of 250.21 g/mol. Its IUPAC name is sodium;2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetic acid;hydride.
| Compound Name | sodium;2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetic acid;hydride |
|---|---|
| PubChem CID | 173396804 |
| Molecular Formula | C7H7N4NaO3S |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | sodium;2-(2-amino-1,3-thiazol-4-yl)-2-(cyanomethoxyimino)acetic acid;hydride |
| SMILES | N#CCON=C(C(=O)O)c1csc(N)n1.[H-].[Na+] |
| InChI | InChI=1S/C7H6N4O3S.Na.H/c8-1-2-14-11-5(6(12)13)4-3-15-7(9)10-4;;/h3H,2H2,(H2,9,10)(H,12,13);;/q;+1;-1 |
| InChIKey | KULBXDTVWKAQHU-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|