C7H8N4O4S — CID 14193034
(2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetic acid (PubChem CID 14193034) has the molecular formula C7H8N4O4S and a molecular weight of 244.23 g/mol. Its IUPAC name is (2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetic acid.
| Compound Name | (2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 14193034 |
| Molecular Formula | C7H8N4O4S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetic acid |
| SMILES | NC(=O)CO/N=C(\C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C7H8N4O4S/c8-4(12)1-15-11-5(6(13)14)3-2-16-7(9)10-3/h2H,1H2,(H2,8,12)(H2,9,10)(H,13,14)/b11-5- |
| InChIKey | MQOQJWOGXYIVBR-WZUFQYTHSA-N |
| XLogP | -0.98 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|