C7H9N5O3S — CID 154043594
(2E)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetamide (PubChem CID 154043594) has the molecular formula C7H9N5O3S and a molecular weight of 243.25 g/mol. Its IUPAC name is (2E)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetamide.
| Compound Name | (2E)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 154043594 |
| Molecular Formula | C7H9N5O3S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | (2E)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetamide |
| SMILES | NC(=O)CO/N=C(/C(N)=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H9N5O3S/c8-4(13)1-15-12-5(6(9)14)3-2-16-7(10)11-3/h2H,1H2,(H2,8,13)(H2,9,14)(H2,10,11)/b12-5+ |
| InChIKey | CRXGKZQSYXRYPD-LFYBBSHMSA-N |
| XLogP | -1.58 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|