C7H6F3N3O3S — CID 54296615
2-(2-amino-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetic acid (PubChem CID 54296615) has the molecular formula C7H6F3N3O3S and a molecular weight of 269.20 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetic acid |
|---|---|
| PubChem CID | 54296615 |
| Molecular Formula | C7H6F3N3O3S |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetic acid |
| SMILES | Nc1nc(C(=NOCC(F)(F)F)C(=O)O)cs1 |
| InChI | InChI=1S/C7H6F3N3O3S/c8-7(9,10)2-16-13-4(5(14)15)3-1-17-6(11)12-3/h1H,2H2,(H2,11,12)(H,14,15) |
| InChIKey | SBFHSELVKUCJBB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|