C12H17N3O4S — CID 54362828
2-(2-amino-1,3-thiazol-4-yl)-2-[(1R,2R)-2-methoxycyclohexyl]oxyiminoacetic acid (PubChem CID 54362828) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-[(1R,2R)-2-methoxycyclohexyl]oxyiminoacetic acid.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-[(1R,2R)-2-methoxycyclohexyl]oxyiminoacetic acid |
|---|---|
| PubChem CID | 54362828 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-[(1R,2R)-2-methoxycyclohexyl]oxyiminoacetic acid |
| SMILES | CO[C@@H]1CCCC[C@H]1ON=C(C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C12H17N3O4S/c1-18-8-4-2-3-5-9(8)19-15-10(11(16)17)7-6-20-12(13)14-7/h6,8-9H,2-5H2,1H3,(H2,13,14)(H,16,17)/t8-,9-/m1/s1 |
| InChIKey | UNRXYZHZXYUHAD-RKDXNWHRSA-N |
| XLogP | 1.49 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|