C14H21N3O4S — CID 88627014
ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxycyclohexyl)oxyiminoacetate (PubChem CID 88627014) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxycyclohexyl)oxyiminoacetate.
| Compound Name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxycyclohexyl)oxyiminoacetate |
|---|---|
| PubChem CID | 88627014 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxycyclohexyl)oxyiminoacetate |
| SMILES | CCOC(=O)/C(=N\OC1CCCCC1OC)c1csc(N)n1 |
| InChI | InChI=1S/C14H21N3O4S/c1-3-20-13(18)12(9-8-22-14(15)16-9)17-21-11-7-5-4-6-10(11)19-2/h8,10-11H,3-7H2,1-2H3,(H2,15,16)/b17-12- |
| InChIKey | ILHFPLRIIOEWAW-ATVHPVEESA-N |
| XLogP | 1.97 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|