C13H18ClN3O3S — CID 88627821
ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chlorocyclohexyl)oxyiminoacetate (PubChem CID 88627821) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chlorocyclohexyl)oxyiminoacetate.
| Compound Name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chlorocyclohexyl)oxyiminoacetate |
|---|---|
| PubChem CID | 88627821 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chlorocyclohexyl)oxyiminoacetate |
| SMILES | CCOC(=O)/C(=N\OC1CCCC(Cl)C1)c1csc(N)n1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-2-19-12(18)11(10-7-21-13(15)16-10)17-20-9-5-3-4-8(14)6-9/h7-9H,2-6H2,1H3,(H2,15,16)/b17-11- |
| InChIKey | PFABVUZNOCAGHJ-BOPFTXTBSA-N |
| XLogP | 2.56 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|